| Name | N-(2-Hydroxyphenyl)piperazine |
| Synonyms | RARECHEM AH CK 0117 2-(1-PIPERAZINO)PHENOL LABOTEST-BB LT01596124 2-piperazin-1-ylphenol 2-(1-Piperazino)phenol o-(1-piperazinyl)phenol 2-(1-Piperazinyl) phenol 2-(piperazin-1-yl)phenol 1-(2-Hydroxyphenyl)piperazine N-(2-Hydroxyphenyl)piperazine 1-(2-HYDROXYPHENYL)PIPERAZINE N-(2-HYDROXYPHENYL)PIPERAZINE 4-(2-hydroxyphenyl)piperazin-1-ium |
| CAS | 1011-17-2 |
| EINECS | 213-782-5 |
| InChI | InChI=1/C10H14N2O/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2/p+1 |
| Molecular Formula | C10H14N2O |
| Molar Mass | 178.23 |
| Density | 1.141 |
| Melting Point | 125-129°C |
| Boling Point | 328.2±27.0 °C(Predicted) |
| Flash Point | 152.3°C |
| Vapor Presure | 0.000101mmHg at 25°C |
| Appearance | White to Brown Powder |
| BRN | 10646 |
| pKa | 11.25±0.35(Predicted) |
| Storage Condition | Room Temprature |
| MDL | MFCD00190246 |
| Risk Codes | R25 - Toxic if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 6.1/PG 3 |
| HS Code | 29339900 |
| Hazard Note | Irritant |
| Hazard Class | 8 |
| Packing Group | III |